4'-Chlorodiazepam
- Product Name4'-Chlorodiazepam
- CAS14439-61-3
- MFC16H12Cl2N2O
- MW319.19
- EINECS
- MOL File14439-61-3.mol
Chemical Properties
| Melting point | 160-163 °C |
| Boiling point | 517.1±50.0 °C(Predicted) |
| Density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | +2C to +8C |
| solubility | ethanol: 17 mg/mL |
| form | Off-white powder |
| pka | 3.08±0.10(Predicted) |
| color | White to light yellow |
| Water Solubility | 2-hydroxypropyl-β-cyclodextrin: insoluble H2O: insoluble |
| BRN | 685202 |
| InChI | 1S/C16H12Cl2N2O/c1-20-14-7-6-12(18)8-13(14)16(19-9-15(20)21)10-2-4-11(17)5-3-10/h2-8H,9H2,1H3 |
| InChIKey | PUMYFTJOWAJIKF-UHFFFAOYSA-N |
| SMILES | O=C1CN=C(C2=CC=C(Cl)C=C2)C3=CC(Cl)=CC=C3N1C |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | DF0500000 |
| F | 10 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 14439-61-3(Hazardous Substances Data) |