Ethyl coumarin-3-carboxylate
- Product NameEthyl coumarin-3-carboxylate
- CAS1846-76-0
- MFC12H10O4
- MW218.21
- EINECS811-043-7
- MOL File1846-76-0.mol
Chemical Properties
| Melting point | 92-94 °C (lit.) |
| Boiling point | 278.88°C (rough estimate) |
| Density | 1.1096 (rough estimate) |
| refractive index | 1.4270 (estimate) |
| storage temp. | Store at -20°C |
| solubility | Soluble in DMSO |
| form | powder to crystal |
| color | White to Almost white |
| λmax | 334nm(CH2Cl2)(lit.) |
| BRN | 200147 |
| InChI | 1S/C12H10O4/c1-2-15-11(13)9-7-8-5-3-4-6-10(8)16-12(9)14/h3-7H,2H2,1H3 |
| InChIKey | XKHPEMKBJGUYCM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=Cc2ccccc2OC1=O |
| CAS DataBase Reference | 1846-76-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | DJ2501000 |
| HazardClass | IRRITANT |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
