COUMARIN 7
- Product NameCOUMARIN 7
- CAS27425-55-4
- MFC20H19N3O2
- MW333.38
- EINECS248-451-4
- MOL File27425-55-4.mol
Chemical Properties
| Melting point | 234-237 °C(lit.) |
| Boiling point | 470.35°C (rough estimate) |
| Density | 1.2071 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | -20°C |
| solubility | DMF: 1 mg/ml; DMSO: 1 mg/ml; Ethanol: insol; PBS (pH 7.2): insol |
| form | Powder |
| pka | 10.83±0.10(Predicted) |
| color | Bright yellow |
| Appearance | White to Light yellow powder to crystal |
| λmax | 438 nm |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C20H19N3O2/c1-3-23(4-2)14-10-9-13-11-15(20(24)25-18(13)12-14)19-21-16-7-5-6-8-17(16)22-19/h5-12H,3-4H2,1-2H3,(H,21,22) |
| InChIKey | GOLORTLGFDVFDW-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(N(CC)CC)=CC=C2C=C1C1NC2=CC=CC=C2N=1 |
| LogP | 3.68 |
| CAS DataBase Reference | 27425-55-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2H-1-Benzopyran-2-one, 3-(1H-benzimidazol-2-yl)-7-(diethylamino)- (27425-55-4) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-38-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
