4-Methyl-1,2,4-triazole-3-thiol
- Product Name4-Methyl-1,2,4-triazole-3-thiol
- CAS24854-43-1
- MFC3H5N3S
- MW115.16
- EINECS246-496-4
- MOL File24854-43-1.mol
Chemical Properties
| Melting point | 165-169°C |
| Boiling point | 135.3±23.0 °C(Predicted) |
| Density | 1.44±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | acetone: soluble2.5%, clear, colorless to faintly yellow |
| form | powder to crystal |
| pka | 9.73±0.20(Predicted) |
| color | White to Light yellow |
| BRN | 110580 |
| InChI | InChI=1S/C3H5N3S/c1-6-2-4-5-3(6)7/h2H,1H3,(H,5,7) |
| InChIKey | AGWWTUWTOBEQFE-UHFFFAOYSA-N |
| SMILES | N1=CN(C)C(=S)N1 |
| CAS DataBase Reference | 24854-43-1(CAS DataBase Reference) |
| EPA Substance Registry System | 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-4-methyl- (24854-43-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| RTECS | XZ5359126 |
| TSCA | TSCA listed |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
