2,3,5,6-Tetrafluoro-4-methylbenzoic acid
- Product Name2,3,5,6-Tetrafluoro-4-methylbenzoic acid
- CAS652-32-4
- MFC8H4F4O2
- MW208.11
- EINECS
- MOL File652-32-4.mol
Chemical Properties
| Melting point | 173-175 °C(lit.) |
| Boiling point | 255.8±35.0 °C(Predicted) |
| Density | 1.4412 (estimate) |
| storage temp. | Store at room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 1.83±0.10(Predicted) |
| color | White to Gray to Brown |
| InChI | 1S/C8H4F4O2/c1-2-4(9)6(11)3(8(13)14)7(12)5(2)10/h1H3,(H,13,14) |
| InChIKey | COOULIOYEXBFDT-UHFFFAOYSA-N |
| SMILES | Cc1c(F)c(F)c(C(O)=O)c(F)c1F |
| CAS DataBase Reference | 652-32-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |