Pinoresinol diMethyl ether
- Product NamePinoresinol diMethyl ether
- CAS29106-36-3
- MFC22H26O6
- MW386.44
- EINECS2017-001-1
- MOL File29106-36-3.mol
Chemical Properties
| Melting point | 107-108℃ |
| Boiling point | 517.3±50.0 °C(Predicted) |
| Density | 1.173±0.06 g/cm3(Predicted) |
| storage temp. | Store at 4℃,protect from light |
| solubility | Soluble in DMSO |
| form | Solid |
| color | White to off-white |
| Major Application | food and beverages |
| InChI | 1S/C22H26O6/c1-23-17-7-5-13(9-19(17)25-3)21-15-11-28-22(16(15)12-27-21)14-6-8-18(24-2)20(10-14)26-4/h5-10,15-16,21-22H,11-12H2,1-4H3/t15-,16-,21+,22+/m0/s1 |
| InChIKey | PEUUVVGQIVMSAW-RZTYQLBFSA-N |
| SMILES | O1[C@@H]([C@@H]3[C@@H]([C@H](OC3)c4cc(c(cc4)OC)OC)C1)c2cc(c(cc2)OC)OC |
