N,N-Diethylbenzamide
- Product NameN,N-Diethylbenzamide
- CAS1696-17-9
- MFC11H15NO
- MW177.24
- EINECS216-912-9
- MOL File1696-17-9.mol
Chemical Properties
| Melting point | 38-40°C |
| Boiling point | 146-150°C 15mm |
| Density | 1.0290 (rough estimate) |
| refractive index | 1.5240 to 1.5280 |
| Flash point | >100°C |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | -1.14±0.70(Predicted) |
| form | clear liquid |
| color | White to Yellow to Green |
| BRN | 1909505 |
| InChI | InChI=1S/C11H15NO/c1-3-12(4-2)11(13)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | JLNGEXDJAQASHD-UHFFFAOYSA-N |
| SMILES | C(N(CC)CC)(=O)C1=CC=CC=C1 |
| CAS DataBase Reference | 1696-17-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzamide, N,N-diethyl- (1696-17-9) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RTECS | CV4202000 |
| TSCA | TSCA listed |
| HS Code | 2924297099 |
| Toxicity | LD50 oral in rat: 2gm/kg |