1-Vinylnaphthalene
- Product Name1-Vinylnaphthalene
- CAS826-74-4
- MFC12H10
- MW154.21
- EINECS212-560-5
- MOL File826-74-4.mol
Chemical Properties
| Melting point | 322 °C |
| Boiling point | 80 °C/0.4 mmHg |
| Density | 1.04 |
| refractive index | 1.64 |
| Flash point | 116 °C |
| storage temp. | -20°C |
| solubility | Soluble in ethyl acetate, hexane and methanol. |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Sensitive | Moisture Sensitive |
| Stability | Stable. Incompatible with strong oxidizing agents. Combustible. |
| InChI | InChI=1S/C12H10/c1-2-10-7-5-8-11-6-3-4-9-12(10)11/h2-9H,1H2 |
| InChIKey | IGGDKDTUCAWDAN-UHFFFAOYSA-N |
| SMILES | C1(C=C)=C2C(C=CC=C2)=CC=C1 |
| CAS DataBase Reference | 826-74-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-51/53-22 |
| Safety Statements | 26-36-61 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 2 |
| HS Code | 2902909000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
