| Melting point |
92-95 °C |
| alpha |
-45 º (c=2, MeOH) |
| Boiling point |
427.77°C (rough estimate) |
| Density |
1.0864 (rough estimate) |
| refractive index |
-42 ° (C=2, MeOH) |
| storage temp. |
Sealed in dry,2-8°C |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form |
powder to crystal |
| pka |
11.86±0.46(Predicted) |
| color |
White to Almost white |
| optical activity |
[α]20/D 30°, c = 1 in chloroform |
| Water Solubility |
insoluble |
| BRN |
2816420 |
| Major Application |
peptide synthesis |
| InChI |
1S/C17H19NO3/c19-12-16(11-14-7-3-1-4-8-14)18-17(20)21-13-15-9-5-2-6-10-15/h1-10,16,19H,11-13H2,(H,18,20)/t16-/m0/s1 |
| InChIKey |
WPOFMMJJCPZPAO-INIZCTEOSA-N |
| SMILES |
OC[C@H](Cc1ccccc1)NC(=O)OCc2ccccc2 |
| CAS DataBase Reference |
6372-14-1(CAS DataBase Reference) |
