1-Phenyl-1-trimethylsiloxyethylene
- Product Name1-Phenyl-1-trimethylsiloxyethylene
- CAS13735-81-4
- MFC11H16OSi
- MW192.33
- EINECS237-308-1
- MOL File13735-81-4.mol
Chemical Properties
| Melting point | 122-123 °C |
| Boiling point | 88-89 °C/11 mmHg (lit.) |
| Density | 0.938 g/mL at 25 °C (lit.) |
| vapor density | >1 (vs air) |
| refractive index | n |
| Flash point | 174 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 0.938 |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 1306914 |
| InChI | 1S/C11H16OSi/c1-10(12-13(2,3)4)11-8-6-5-7-9-11/h5-9H,1H2,2-4H3 |
| InChIKey | AFFPCIMDERUIST-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC(=C)c1ccccc1 |
| CAS DataBase Reference | 13735-81-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 2931900090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
