1,3-Diisopropylimidazolium tetrafluoroborate
- Product Name1,3-Diisopropylimidazolium tetrafluoroborate
- CAS286014-34-4
- MFC9H17N2.BF4
- MW240.05
- EINECS
- MOL File286014-34-4.mol
Chemical Properties
| Melting point | 62-79 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | Light yellow to Brown |
| InChI | 1S/C9H17N2.BF4/c1-8(2)10-5-6-11(7-10)9(3)4;2-1(3,4)5/h5-9H,1-4H3;/q+1;-1 |
| InChIKey | PSKQPXYUPOKHPY-UHFFFAOYSA-N |
| SMILES | F[B-](F)(F)F.CC(C)n1cc[n+](c1)C(C)C |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2933299090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |