7-Methoxy-1-indanone 97
- Product Name7-Methoxy-1-indanone 97
- CAS34985-41-6
- MFC10H10O2
- MW162.19
- EINECS233-305-4
- MOL File34985-41-6.mol
Chemical Properties
| Melting point | 99-102 °C |
| Boiling point | 305℃ |
| Density | 1.166 |
| Flash point | 147℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C10H10O2/c1-12-9-4-2-3-7-5-6-8(11)10(7)9/h2-4H,5-6H2,1H3 |
| InChIKey | CZXBVBATQPHSSL-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2OC)CC1 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36-43 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |