1,3-Dimethylimidazolium methylsulfate
- Product Name1,3-Dimethylimidazolium methylsulfate
- CAS97345-90-9
- MFC6H12N2O4S
- MW208.24
- EINECS200-100-5
- MOL File97345-90-9.mol
Chemical Properties
| Melting point | 35.75 °C |
| Density | 1.33 g/mL at 20 °C(lit.) |
| refractive index | 1.4810 to 1.4850 |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Water Solubility | Soluble in water. |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C5H9N2.CH4O4S/c1-6-3-4-7(2)5-6;1-5-6(2,3)4/h3-5H,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | WOKQGMYCUGJNIJ-UHFFFAOYSA-M |
| SMILES | COS([O-])(=O)=O.Cn1cc[n+](C)c1 |
Safety Information
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 2933.29.9000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
