1-BroMoheptadecafluorooctane
- Product Name1-BroMoheptadecafluorooctane
- CAS423-55-2
- MFC8BrF17
- MW498.96
- EINECS207-028-4
- MOL File423-55-2.mol
Chemical Properties
| Melting point | 6 °C |
| Boiling point | 142 °C(lit.) |
| Density | 1.93 g/mL at 25 °C(lit.) |
| vapor pressure | 12.8-72hPa at 25-65℃ |
| refractive index | n |
| Flash point | 141-143°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in DMSO |
| form | Viscous Solution |
| Specific Gravity | 1.930 |
| color | Colorless to tan |
| Water Solubility | Not miscible or difficult to mix in water. |
| Merck | 14,7156 |
| BRN | 2016022 |
| Cosmetics Ingredients Functions | SOLVENT |
| InChI | 1S/C8BrF17/c9-7(22,23)5(18,19)3(14,15)1(10,11)2(12,13)4(16,17)6(20,21)8(24,25)26 |
| InChIKey | WTWWXOGTJWMJHI-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Br |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | RG8700000 |
| Hazard Note | Irritant |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29037800 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 i.v. in female rats: 41 g/kg (Burgan) |
