| Boiling point |
196-198 °C (lit.) |
| Density |
1.147 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.441(lit.) |
| Flash point |
203 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
clear liquid |
| color |
Colorless to Light yellow to Light orange |
| InChI |
InChI=1S/C7H10O4/c1-10-5(8)7(3-4-7)6(9)11-2/h3-4H2,1-2H3 |
| InChIKey |
PWLLZZMFFZUSOG-UHFFFAOYSA-N |
| SMILES |
C(C1(CC1)C(=O)OC)(=O)OC |
| CAS DataBase Reference |
6914-71-2(CAS DataBase Reference) |
| EPA Substance Registry System |
1,1-Cyclopropanedicarboxylic acid, dimethyl ester (6914-71-2) |
