MORPHINE-D3
- Product NameMORPHINE-D3
- CAS67293-88-3
- MFC17H19NO3
- MW285.34
- EINECS621-670-6
- MOL File67293-88-3.mol
Chemical Properties
| Melting point | >2400C (dec,) |
| Flash point | 11 °C |
| storage temp. | −20°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Major Application | forensics and toxicology |
| InChI | 1S/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,13,16,19-20H,6-8H2,1H3/t10-,11+,13-,16-,17-/m0/s1/i1D3 |
| InChIKey | BQJCRHHNABKAKU-LLQNGXJRSA-N |
| SMILES | O[C@@H](C=C1)[C@H]2C(C1C3C4)(CCN3C([2H])([2H])[2H])C5=C4C=CC(O)=C5O2 |
Safety Information
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 36/37-45-16-7 |
| RIDADR | UN 1230 3/PG 2 |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |