MORPHINE-D6
- Product NameMORPHINE-D6
- CAS1334606-17-5
- MFC17H13D6NO3
- MW291.38
- EINECS802-938-3
- MOL FileMol File
Chemical Properties
| Melting point | >235C (dec.) |
| Boiling point | 476.247±45.00 °C(Press: 760.00 Torr)(predicted) |
| Density | 1.444±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| Flash point | 9℃ |
| storage temp. | Controlled Substance, -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.479±0.40(predicted) |
| color | White to Off-White |
| Major Application | forensics and toxicology |
| InChIKey | BQJCRHHNABKAKU-VVVKWITHSA-N |
| SMILES | [2H]C1N([C@@H]2Cc3ccc(O)c4O[C@H]5[C@@H](O)C=C[C@@H]2[C@]5(c34)C1([2H])[2H])C([2H])([2H])[2H] |
Safety Information
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 7-16-36/37-45 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 1 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |