3-(Acryloyloxy)propyltrimethoxysilane
- Product Name3-(Acryloyloxy)propyltrimethoxysilane
- CAS4369-14-6
- MFC9H18O5Si
- MW234.32
- EINECS419-560-6
- MOL File4369-14-6.mol
Chemical Properties
| Boiling point | 68 °C0.4 mm Hg(lit.) |
| Density | 1.055 g/mL at 25 °C(lit.) |
| vapor pressure | 20.5Pa at 25℃ |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Miscible with organic solvents. |
| form | Liquid |
| Specific Gravity | 1.0 |
| color | Clear colorless |
| Water Solubility | 5.8-4300mg/L at 20℃ |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 2046320 |
| Cosmetics Ingredients Functions | SOLVENT |
| InChI | 1S/C9H18O5Si/c1-5-9(10)14-7-6-8-15(11-2,12-3)13-4/h5H,1,6-8H2,2-4H3 |
| InChIKey | KBQVDAIIQCXKPI-UHFFFAOYSA-N |
| SMILES | CO[Si](CCCOC(=O)C=C)(OC)OC |
Safety Information
| Hazard Codes | Xi,C |
| Risk Statements | 37/38-41-52/53-43-37-34-20 |
| Safety Statements | 26-39-61-45-36/37/39 |
| RIDADR | UN1760 |
| WGK Germany | 3 |
| RTECS | UD3810000 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Inhalation Aquatic Chronic 3 Eye Dam. 1 Skin Corr. 1B Skin Sens. 1 |
