2,5-Bis(4-aminophenyl)-1,3,4-oxadiazole
- Product Name2,5-Bis(4-aminophenyl)-1,3,4-oxadiazole
- CAS2425-95-8
- MFC14H12N4O
- MW252.27
- EINECS219-373-8
- MOL File2425-95-8.mol
Chemical Properties
| Melting point | 250-254 °C(lit.) |
| Boiling point | 508.1±60.0 °C(Predicted) |
| Density | 1.301±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.53±0.10(Predicted) |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| BRN | 243757 |
| InChI | 1S/C14H12N4O/c15-11-5-1-9(2-6-11)13-17-18-14(19-13)10-3-7-12(16)8-4-10/h1-8H,15-16H2 |
| InChIKey | MJZXFMSIHMJQBW-UHFFFAOYSA-N |
| SMILES | Nc1ccc(cc1)-c2nnc(o2)-c3ccc(N)cc3 |
| CAS DataBase Reference | 2425-95-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| F | 8-9-23 |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
