N,N-Dimethylformamide di-tert-butyl acetal
- Product NameN,N-Dimethylformamide di-tert-butyl acetal
- CAS36805-97-7
- MFC11H25NO2
- MW203.32
- EINECS253-222-7
- MOL File36805-97-7.mol
Chemical Properties
| Boiling point | 56-57 °C8 mm Hg(lit.) |
| Density | 0.848 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 93 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Miscible with toluene and benzene. |
| pka | 5.34±0.50(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.848 |
| Sensitive | Moisture Sensitive |
| BRN | 969629 |
| InChI | InChI=1S/C11H25NO2/c1-10(2,3)13-9(12(7)8)14-11(4,5)6/h9H,1-8H3 |
| InChIKey | DBNQIOANXZVWIP-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(OC(C)(C)C)N(C)C |
| CAS DataBase Reference | 36805-97-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29221990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |