Chemical Properties
| Boiling point | 609.386±55.00 °C(Press: 760.00 Torr)(predicted) |
| Density | 1.496±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| storage temp. | 2-8°C |
| form | Solid |
| pka | 7.412±0.70(predicted) |
| color | White to off-white |
| Major Application | food and beverages |
| InChI | InChI=1/C15H16O6/c1-15-6-12(18)10(16)5-9(15)8-3-7(20-2)4-11(17)13(8)14(19)21-15/h3-5,10,12,16-18H,6H2,1-2H3/t10-,12-,15-/s3 |
| InChIKey | MMHTXEATDNFMMY-BSZOFMBKNA-N |
| SMILES | [C@@]12(C)C[C@@H](O)[C@H](O)C=C1C1=CC(OC)=CC(O)=C1C(=O)O2 |&1:0,3,5,r| |
Safety Information
| Hazard Codes | T+ |
| Risk Statements | 61-26/27/28 |
| Safety Statements | 53-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | HP8758000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |