4-(Dicyanomethylene)-2-methyl-6-(4-dimethylaminostyryl)-4H-pyran
- Product Name4-(Dicyanomethylene)-2-methyl-6-(4-dimethylaminostyryl)-4H-pyran
- CAS51325-91-8
- MFC19H17N3O
- MW303.36
- EINECS257-137-6
- MOL File51325-91-8.mol
Chemical Properties
| Melting point | 215-220 °C(lit.) |
| Boiling point | 444.29°C (rough estimate) |
| Density | 1.239 |
| refractive index | 1.5900 (estimate) |
| Flash point | 110 °F |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 5.46±0.24(Predicted) |
| form | Powder or Crystalline Needles |
| color | Dark red |
| Appearance | Dark red to Brown powder to crystal |
| ex/em | λex 471, 372, 352 nm; λem 627, 601 nm in EtOH |
| λmax | 468 nm |
| Merck | 14,2838 |
| InChI | InChI=1S/C19H17N3O/c1-14-10-16(17(12-20)13-21)11-19(23-14)9-6-15-4-7-18(8-5-15)22(2)3/h4-11H,1-3H3 |
| InChIKey | YLYPIBBGWLKELC-UHFFFAOYSA-N |
| SMILES | C(#N)/C(=C1/C=C(C)OC(C=CC2=CC=C(N(C)C)C=C2)=C/1)/C#N |
| EPA Substance Registry System | Propanedinitrile, [2-[2-[4-(dimethylamino)phenyl]ethenyl]-6-methyl-4H-pyran-4-ylidene]- (51325-91-8) |
Safety Information
| Hazard Codes | F,Xn |
| Risk Statements | 11-20-36/37/38-20/21/22-10 |
| Safety Statements | 16-26-36-7/9-36/37 |
| RIDADR | UN 3175 4.1/PG 2 |
| WGK Germany | 3 |
| RTECS | OO3746100 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29329990 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Inhalation Eye Irrit. 2 Flam. Sol. 1 Skin Irrit. 2 STOT SE 3 |
