| Melting point |
133-136 °C |
| Boiling point |
307.83°C (rough estimate) |
| Density |
1.1102 (rough estimate) |
| vapor pressure |
0.001Pa at 25℃ |
| refractive index |
1.7110 (estimate) |
| storage temp. |
Sealed in dry,2-8°C |
| solubility |
soluble in Methanol |
| form |
powder to crystal |
| pka |
9.54±0.70(Predicted) |
| color |
White to Light yellow |
| Water Solubility |
754.801mg/L at 30℃ |
| InChI |
InChI=1S/C10H12N2O/c1-8-7-12(11-10(8)13)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,13) |
| InChIKey |
ZZEYCGJAYIHIAZ-UHFFFAOYSA-N |
| SMILES |
N1(C2=CC=CC=C2)CC(C)C(=O)N1 |
| LogP |
0.624 at 25℃ |
| CAS DataBase Reference |
2654-57-1(CAS DataBase Reference) |
| EPA Substance Registry System |
3-Pyrazolidinone, 4-methyl-1-phenyl- (2654-57-1) |
