3-Nitropropiophenone
- Product Name3-Nitropropiophenone
- CAS17408-16-1
- MFC9H9NO3
- MW179.17
- EINECS241-435-8
- MOL File17408-16-1.mol
Chemical Properties
| Melting point | 98-101 °C (lit.) |
| Boiling point | 254.5±13.0 °C(Predicted) |
| Density | 1.199±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Yellow to Green |
| BRN | 1954069 |
| InChI | 1S/C9H9NO3/c1-2-9(11)7-4-3-5-8(6-7)10(12)13/h3-6H,2H2,1H3 |
| InChIKey | VSPOTMOYDHRALZ-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1cccc(c1)[N+]([O-])=O |
| CAS DataBase Reference | 17408-16-1(CAS DataBase Reference) |
| NIST Chemistry Reference | m-Nitropropiophenone(17408-16-1) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2914790090 |
| Storage Class | 13 - Non Combustible Solids |
