4-(trans-4-Propylcyclohexyl)phenol
- Product Name4-(trans-4-Propylcyclohexyl)phenol
- CAS81936-33-6
- MFC15H22O
- MW218.34
- EINECS440-740-5
- MOL File81936-33-6.mol
Chemical Properties
| Melting point | 138°C(lit.) |
| Boiling point | 339.8±21.0 °C(Predicted) |
| Density | 0.978±0.06 g/cm3(Predicted) |
| vapor pressure | 0.002Pa at 25℃ |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 10.21±0.30(Predicted) |
| color | White to Light yellow |
| Water Solubility | 125μg/L at 20℃ |
| InChI | InChI=1S/C15H22O/c1-2-3-12-4-6-13(7-5-12)14-8-10-15(16)11-9-14/h8-13,16H,2-7H2,1H3/t12-,13- |
| InChIKey | AHAZEMSUUYFDMM-JOCQHMNTSA-N |
| SMILES | C1(O)=CC=C([C@@H]2CC[C@@H](CCC)CC2)C=C1 |
| LogP | 5 at 40℃ |
| CAS DataBase Reference | 81936-33-6(CAS DataBase Reference) |