| Melting point |
>300°C |
| Density |
1.436[at 20℃] |
| vapor pressure |
0Pa at 25℃ |
| storage temp. |
Inert atmosphere,Room Temperature |
| form |
powder to crystal |
| color |
White to Almost white |
| Water Solubility |
almost transparency |
| Hydrolytic Sensitivity |
0: forms stable aqueous solutions |
| Stability |
Stable. Incompatible with peroxides, strong acids, strong oxidizing agents. |
| InChI |
InChI=1S/C7H12O5S.K/c1-6(2)7(8)12-4-3-5-13(9,10)11;/h1,3-5H2,2H3,(H,9,10,11);/q;+1/p-1 |
| InChIKey |
PNOXUQIZPBURMT-UHFFFAOYSA-M |
| SMILES |
S([O-])(=O)(=O)CCCOC(=O)C(=C)C.[K+] |
| LogP |
-3.1 |
| CAS DataBase Reference |
31098-21-2(CAS DataBase Reference) |
| EPA Substance Registry System |
2-Propenoic acid, 2-methyl-, 3-sulfopropyl ester, potassium salt (31098-21-2) |
