| Melting point |
138-140 °C (lit.) |
| Boiling point |
287.4±23.0 °C(Predicted) |
| Density |
1.1960 (rough estimate) |
| refractive index |
1.5500 (estimate) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
methanol: 50 mg/mL, clear |
| form |
powder to crystal |
| pka |
11.01±0.70(Predicted) |
| color |
White to Almost white |
| BRN |
608285 |
| InChI |
InChI=1S/C7H9N3S/c8-10-7(11)9-6-4-2-1-3-5-6/h1-5H,8H2,(H2,9,10,11) |
| InChIKey |
KKIGUVBJOHCXSP-UHFFFAOYSA-N |
| SMILES |
N(C(NC1=CC=CC=C1)=S)N |
| CAS DataBase Reference |
5351-69-9(CAS DataBase Reference) |
| EPA Substance Registry System |
Hydrazinecarbothioamide, N-phenyl- (5351-69-9) |
