4,4'-Bis(chloromethyl)-1,1'-biphenyl
- Product Name4,4'-Bis(chloromethyl)-1,1'-biphenyl
- CAS1667-10-3
- MFC14H12Cl2
- MW251.15
- EINECS216-784-4
- MOL File1667-10-3.mol
Chemical Properties
| Melting point | 126 °C (dec.)(lit.) |
| Boiling point | 184 °C / 0.2mmHg |
| Density | 1.195±0.06 g/cm3(Predicted) |
| vapor pressure | 4.6Pa at 20℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Tetrahydrofuran |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | 200ng/L at 20℃ |
| InChI | InChI=1S/C14H12Cl2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H,9-10H2 |
| InChIKey | INZDTEICWPZYJM-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(CCl)C=C2)=CC=C(CCl)C=C1 |
| LogP | 4.61 at 25℃ |
| CAS DataBase Reference | 1667-10-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 29039990 |
