H-Pro-OtBu
- Product NameH-Pro-OtBu
- CAS2812-46-6
- MFC9H17NO2
- MW171.24
- EINECS220-558-0
- MOL File2812-46-6.mol
Chemical Properties
| Melting point | 98-103°C |
| Boiling point | 219.2±33.0 °C(Predicted) |
| Density | 0.995±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 8.32±0.10(Predicted) |
| form | Liquid |
| color | Colorless to pale yellow |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C9H17NO2/c1-9(2,3)12-8(11)7-5-4-6-10-7/h7,10H,4-6H2,1-3H3/t7-/m0/s1 |
| InChIKey | XJJBXZIKXFOMLP-ZETCQYMHSA-N |
| SMILES | C(OC(C)(C)C)(=O)[C@@H]1CCCN1 |
| CAS DataBase Reference | 2812-46-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-36/37/39-45 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
