4-Benzyloxy-3-methoxyphenylacetic acid
- Product Name4-Benzyloxy-3-methoxyphenylacetic acid
- CAS29973-91-9
- MFC16H16O4
- MW272.3
- EINECS
- MOL File29973-91-9.mol
Chemical Properties
| Melting point | 100-102 °C (lit.) |
| Boiling point | 440.1±35.0 °C(Predicted) |
| Density | 1+-.0.06 g/cm3(Predicted) |
| pka | 4.33±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | 1S/C16H16O4/c1-19-15-9-13(10-16(17)18)7-8-14(15)20-11-12-5-3-2-4-6-12/h2-9H,10-11H2,1H3,(H,17,18) |
| InChIKey | AYCIHUSEBJLTBF-UHFFFAOYSA-N |
| SMILES | COc1cc(CC(O)=O)ccc1OCc2ccccc2 |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2918999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |