3-Methoxyphenylacetic acid
- Product Name3-Methoxyphenylacetic acid
- CAS1798-09-0
- MFC9H10O3
- MW166.17
- EINECS217-282-8
- MOL File1798-09-0.mol
Chemical Properties
| Melting point | 65-69 °C (lit.) |
| Boiling point | 306 °C |
| Density | 1.1708 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform and Ethyl Acetate. |
| pka | 4.19±0.10(Predicted) |
| form | Flakes |
| color | White to slightly yellow |
| Water Solubility | SLIGHTLY SOLUBLE |
| BRN | 2614004 |
| InChI | InChI=1S/C9H10O3/c1-12-8-4-2-3-7(5-8)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| InChIKey | LEGPZHPSIPPYIO-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC(OC)=C1 |
| LogP | 1.500 |
| CAS DataBase Reference | 1798-09-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzeneacetic acid, 3-methoxy-(1798-09-0) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | AI8940000 |
| HazardClass | IRRITANT |
| HS Code | 29189090 |
