tert-Butylmagnesium chloride
- Product Nametert-Butylmagnesium chloride
- CAS677-22-5
- MFC4H9ClMg
- MW116.87
- EINECS211-638-6
- MOL File677-22-5.mol
Chemical Properties
| Melting point | -108℃ (Tetrahydrofuran) |
| Density | 0.931 g/mL at 25 °C |
| Flash point | 34 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear brown to dark brown |
| Water Solubility | Miscible with alcohol and water. |
| Sensitive | Air & Moisture Sensitive |
| BRN | 3535403 |
| InChI | InChI=1S/C4H9.ClH.Mg/c1-4(2)3;;/h1-3H3;1H;/q;;+1/p-1 |
| InChIKey | ZDRJSYVHDMFHSC-UHFFFAOYSA-M |
| SMILES | C(C)(C)(C)[Mg]Cl |
| CAS DataBase Reference | 677-22-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | F+,C,F |
| Risk Statements | 12-14/15-19-22-34-66-67-15-11-14-37-17-40 |
| Safety Statements | 9-16-26-29-33-36/37/39-43-45 |
| RIDADR | UN 3399 4.3/PG 1 |
| WGK Germany | 1 |
| F | 1-3-10 |
| HazardClass | 4.3 |
| PackingGroup | I |
| HS Code | 29319090 |
| Storage Class | 4.2 - Pyrophoric and self-heating hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Flam. Liq. 2 Pyr. Liq. 1 Skin Corr. 1B STOT SE 3 Water-react 1 |