(1S,2R,5S)-(+)-Menthyl (R)-p-toluenesulfinate
- Product Name(1S,2R,5S)-(+)-Menthyl (R)-p-toluenesulfinate
- CAS91796-57-5
- MFC17H26O2S
- MW294.45
- EINECS
- MOL File91796-57-5.mol
Chemical Properties
| Melting point | 104-106 °C(lit.) |
| Boiling point | 402.3±38.0 °C(Predicted) |
| Density | 1.08±0.1 g/cm3(Predicted) |
| refractive index | 200 ° (C=2, Acetone) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D +200°, c = 2 in acetone |
| BRN | 4907352 |
| InChI | 1S/C17H26O2S/c1-12(2)16-10-7-14(4)11-17(16)19-20(18)15-8-5-13(3)6-9-15/h5-6,8-9,12,14,16-17H,7,10-11H2,1-4H3/t14-,16+,17-,20/m1/s1 |
| InChIKey | NQICGNSARVCSGJ-IUINDACWSA-N |
| SMILES | C[C@@H]1CC[C@@H](C(C)C)[C@@H](C1)OS(=O)c2ccc(C)cc2 |
| CAS DataBase Reference | 91796-57-5(CAS DataBase Reference) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2930.90.2900 |
| Storage Class | 13 - Non Combustible Solids |