1-Butyl-2,3-dimethylimidazolium hexafluorophosphate
- Product Name1-Butyl-2,3-dimethylimidazolium hexafluorophosphate
- CAS227617-70-1
- MFC9H17F6N2P
- MW298.21
- EINECS200-145-6
- MOL File227617-70-1.mol
Chemical Properties
| Melting point | 50°C |
| Density | 1.345 g/mL at 20 °C(lit.) |
| refractive index | n |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | 1S/C9H17N2.F6P/c1-4-5-6-11-8-7-10(3)9(11)2;1-7(2,3,4,5)6/h7-8H,4-6H2,1-3H3;/q+1;-1 |
| InChIKey | JWFPQAXAGSAKRF-UHFFFAOYSA-N |
| SMILES | F[P-](F)(F)(F)(F)F.CCCCn1cc[n+](C)c1C |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29332900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
