1 2-Dime-3-propylimidazolium bis(trifluo
- Product Name1 2-Dime-3-propylimidazolium bis(trifluo
- CAS169051-76-7
- MFC8H15N2.C2F6NO4S2
- MW419.366
- EINECS805-807-9
- MOL File169051-76-7.mol
Chemical Properties
| Melting point | 15 °C (lit.) |
| Density | 1.436 g/mL at 25 °C |
| vapor pressure | 1.6-18.665hPa at 20-260℃ |
| refractive index | n20/D 1.433 |
| Flash point | >110°C |
| storage temp. | Store at room temperature, keep dry and cool |
| form | liquid |
| Specific Gravity | 1.47 |
| color | colorless to pale yellow |
| InChI | 1S/C8H15N2.C2F6NO4S2/c1-4-5-10-7-6-9(3)8(10)2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h6-7H,4-5H2,1-3H3;/q+1;-1 |
| InChIKey | XOZHIVUWCICHSQ-UHFFFAOYSA-N |
| SMILES | CCC[n+]1ccn(C)c1C.FC(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
| LogP | 2.369 at 25℃ and pH6-7 |
| CAS DataBase Reference | 169051-76-7 |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29350090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |