| Boiling point |
78°C/0.3mmHg(lit.) |
| Density |
1.033±0.06 g/cm3(Predicted) |
| vapor pressure |
0.6Pa at 20℃ |
| refractive index |
1.4620 to 1.4660 |
| form |
clear liquid |
| color |
Colorless to Light yellow |
| Water Solubility |
9.3g/L at 25℃ |
| Stability |
Unstable; may be sold with an inhibitor added. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C10H16O4/c1-3-9(11)14-7-10(4-2)5-12-8-13-6-10/h3H,1,4-8H2,2H3 |
| InChIKey |
STGXUBIZGYMIRM-UHFFFAOYSA-N |
| SMILES |
C(OCC1(CC)COCOC1)(=O)C=C |
| LogP |
1.9 at 23℃ |
| EPA Substance Registry System |
2-Propenoic acid, (5-ethyl-1,3-dioxan-5-yl)methyl ester (66492-51-1) |
