Phenol-d6
- Product NamePhenol-d6
- CAS13127-88-3
- MFC6D6O
- MW100.15
- EINECS236-063-8
- MOL File13127-88-3.mol
Chemical Properties
| Melting point | 40-42 °C (lit.) |
| Boiling point | 182 °C (lit.) |
| Density | 1.140 g/mL at 25 °C |
| vapor density | 3.24 (vs air) |
| vapor pressure | 0.36 mm Hg ( 20 °C) |
| Flash point | 175 °F |
| storage temp. | 2-8°C |
| solubility | 84g/l |
| form | Solid Mass (Deliquescent) |
| PH | 5 (50g/l, H2O, 20℃) |
| explosive limit | 1.3-9.5%(V) |
| BRN | 2255089 |
| Stability | Stable. Incompatible with strong acids, strong bases, strong oxidizing agents. |
| InChI | 1S/C6H6O/c7-6-4-2-1-3-5-6/h1-5,7H/i1D,2D,3D,4D,5D/hD |
| InChIKey | ISWSIDIOOBJBQZ-QNKSCLMFSA-N |
| SMILES | [2H]Oc1c([2H])c([2H])c([2H])c([2H])c1[2H] |
| CAS DataBase Reference | 13127-88-3(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol-d6 (13127-88-3) |
Safety Information
| Hazard Codes | T,C,Xn |
| Risk Statements | 23/24/25-34-48/20/21/22-68-40 |
| Safety Statements | 24/25-26-28-36/37/39-45-36/37 |
| RIDADR | UN 1671 6.1/PG 2 |
| WGK Germany | 2 |
| F | 3-8-10-23 |
| Autoignition Temperature | 1319 °F |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 28459000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 2 Eye Dam. 1 Muta. 2 Skin Corr. 1B STOT RE 2 |
