Chemical Properties
| Melting point | 40-42 °C(lit.) |
| Boiling point | 182 °C(lit.) |
| Density | 1.127 g/mL at 25 °C |
| Flash point | 175 °F |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethyl Acetate (Slightly), Methan |
| form | Low-Melting Solid |
| color | White to Off-White |
| Stability | Stable, but may be moisture sensitive. May be light sensitive. Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C6H6O/c7-6-4-2-1-3-5-6/h1-5,7H |
| InChIKey | ISWSIDIOOBJBQZ-RALIUCGRSA-N |
| SMILES | OC1C([H])=C([H])C([H])=C([H])C=1[H] |
| CAS DataBase Reference | 4165-62-2 |
| EPA Substance Registry System | Phenol-d5 (4165-62-2) |
| CAS Number Unlabeled | 108-95-2 |
Safety Information
| Hazard Codes | T,C |
| Risk Statements | 23/24/25-34-48/20/21/22-68 |
| Safety Statements | 24/25-26-28-36/37/39-45 |
| RIDADR | UN 1671 6.1/PG 2 |
| WGK Germany | 2 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 2 Eye Dam. 1 Muta. 2 Skin Corr. 1B STOT RE 2 |
