1,4-Dibromo-2,5-dimethoxybenzene
- Product Name1,4-Dibromo-2,5-dimethoxybenzene
- CAS2674-34-2
- MFC8H8Br2O2
- MW295.96
- EINECS
- MOL File2674-34-2.mol
Chemical Properties
| Melting point | 144-149 °C (lit.) |
| Boiling point | 290.3±35.0 °C(Predicted) |
| Density | 2,24 g/cm3 |
| refractive index | 1.4947 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Insoluble in water. |
| BRN | 1953103 |
| InChI | InChI=1S/C8H8Br2O2/c1-11-7-3-6(10)8(12-2)4-5(7)9/h3-4H,1-2H3 |
| InChIKey | CHCLRVOURKGRSW-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(OC)=C(Br)C=C1OC |
| CAS DataBase Reference | 2674-34-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2909303890 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |