Methyl quinoline-6-carboxylate
- Product NameMethyl quinoline-6-carboxylate
- CAS38896-30-9
- MFC11H9NO2
- MW187.19
- EINECS217-925-2
- MOL File38896-30-9.mol
Chemical Properties
| Melting point | 88 °C |
| Boiling point | 315.1±15.0 °C(Predicted) |
| Density | 1.210±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.06±0.10(Predicted) |
| color | White to Light yellow to Dark green |
| InChI | InChI=1S/C11H9NO2/c1-14-11(13)9-4-5-10-8(7-9)3-2-6-12-10/h2-7H,1H3 |
| InChIKey | XSRWQTDEIOHXSL-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(C(OC)=O)=CC=2)C=CC=1 |
| CAS DataBase Reference | 38896-30-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 29334900 |