1-(Chloromethyl)-1H-benzotriazole
- Product Name1-(Chloromethyl)-1H-benzotriazole
- CAS54187-96-1
- MFC7H6ClN3
- MW167.6
- EINECS
- MOL File54187-96-1.mol
Chemical Properties
| Melting point | 136-139 °C(lit.) |
| Boiling point | 305.9±25.0 °C(Predicted) |
| Density | 1.42±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 1.13±0.30(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C7H6ClN3/c8-5-11-7-4-2-1-3-6(7)9-10-11/h1-4H,5H2 |
| InChIKey | VSEROABGEVRIRY-UHFFFAOYSA-N |
| SMILES | N1(CCl)C2=CC=CC=C2N=N1 |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2933.99.8290 |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |