Arecaidine hydrochloride
- Product NameArecaidine hydrochloride
- CAS6018-28-6
- MFC7H12ClNO2
- MW177.63
- EINECS
- MOL File6018-28-6.mol
Chemical Properties
| Melting point | 260°C |
| storage temp. | Inert atmosphere,2-8°C |
| form | Solid |
| color | White to light yellow |
| Merck | 14,777 |
| BRN | 3913792 |
| Major Application | food and beverages pharmaceutical |
| InChI | InChI=1S/C7H11NO2.ClH/c1-8-4-2-3-6(5-8)7(9)10;/h3H,2,4-5H2,1H3,(H,9,10);1H |
| InChIKey | PIVDNPNYIBGXPL-UHFFFAOYSA-N |
| SMILES | C1(C(=O)O)=CCCN(C)C1.Cl |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| RTECS | QT2087000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
