2',4'-Dichloropropiophenone
- Product Name2',4'-Dichloropropiophenone
- CAS37885-41-9
- MFC9H8Cl2O
- MW203.07
- EINECS253-700-5
- MOL File37885-41-9.mol
Chemical Properties
| Boiling point | 121-123°C 7mm |
| Density | 1,287 g/cm3 |
| refractive index | 1.551-1.553 |
| Flash point | >110°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump |
| color | White to Light yellow |
| Water Solubility | Slightly soluble in water |
| BRN | 2248270 |
| InChI | InChI=1S/C9H8Cl2O/c1-2-9(12)7-4-3-6(10)5-8(7)11/h3-5H,2H2,1H3 |
| InChIKey | FBMTWRZQBRHOPF-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Cl)C=C1Cl)(=O)CC |
| CAS DataBase Reference | 37885-41-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| HS Code | 2914.79.9000 |