Solvent Blue 35
- Product NameSolvent Blue 35
- CAS17354-14-2
- MFC22H26N2O2
- MW350.45
- EINECS241-379-4
- MOL File17354-14-2.mol
Chemical Properties
| Melting point | 120-122 °C(lit.) |
| Boiling point | 568.7±50.0 °C(Predicted) |
| Density | 1.179±0.06 g/cm3(Predicted) |
| vapor pressure | 0-0Pa at 20-50℃ |
| storage temp. | room temp |
| solubility | Chloroform (Slightly), DMSO (Slightly, Sonicated) |
| pka | 5.45±0.20(Predicted) |
| form | Powder |
| Colour Index | 61554 |
| color | Dark red-purple almost black |
| ε(extinction coefficient) | ≥16000 at 648-652nm in chloroform at 0.01g/L |
| BRN | 2398560 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | HAIR DYEING |
| InChI | 1S/C22H26N2O2/c1-3-5-13-23-17-11-12-18(24-14-6-4-2)20-19(17)21(25)15-9-7-8-10-16(15)22(20)26/h7-12,23-24H,3-6,13-14H2,1-2H3 |
| InChIKey | OCQDPIXQTSYZJL-UHFFFAOYSA-N |
| SMILES | CCCCNc1ccc(NCCCC)c2C(=O)c3ccccc3C(=O)c12 |
| LogP | 6.1 at 23℃ and pH7 |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 32041990 |
| Storage Class | 11 - Combustible Solids |
