1-Butyl-3-methylimidazolium methanesulfonate
- Product Name1-Butyl-3-methylimidazolium methanesulfonate
- CAS342789-81-5
- MFC9H18N2O3S
- MW234.32
- EINECS205-516-1
- MOL File342789-81-5.mol
Chemical Properties
| Melting point | 75-80°C |
| Flash point | 119 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C8H15N2.CH4O3S/c1-3-4-5-10-7-6-9(2)8-10;1-5(2,3)4/h6-8H,3-5H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | PUHVBRXUKOGSBC-UHFFFAOYSA-M |
| SMILES | CS([O-])(=O)=O.CCCCn1cc[n+](C)c1 |
Safety Information
| Hazard Codes | C,T |
| Risk Statements | 22-34-52/53-25 |
| Safety Statements | 26-36/37/39-45-61 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 2 |
| F | 3-10 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29332900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Skin Corr. 1B |