Chemical Properties
| Melting point | 130-133℃ |
| Boiling point | 1075.7±65.0 °C(Predicted) |
| Density | 1.84±0.1 g/cm3 (20 ºC 760 Torr) |
| refractive index | 10 ° (C=4, H2O) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | H2O : 300 mg/mL (450.06 mM; Need ultrasonic and warming) |
| pka | 12.76±0.70(Predicted) |
| form | Solid |
| color | White to off-white |
| BRN | 6171779 |
| Major Application | food and beverages |
| InChIKey | FLDFNEBHEXLZRX-DLQNOBSRSA-N |
| SMILES | OC[C@H]1O[C@H](O[C@]4(CO[C@]3(CO[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]3O)O[C@H](CO)[C@@H](O)[C@@H]4O)[C@H](O)[C@@H](O)[C@@H]1O |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |