Decyltrimethylammonium bromide
- Product NameDecyltrimethylammonium bromide
- CAS2082-84-0
- MFC13H30BrN
- MW280.29
- EINECS218-219-7
- MOL File2082-84-0.mol
Chemical Properties
| Melting point | 243 °C |
| Density | 1.1819 (rough estimate) |
| refractive index | 1.5260 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Chunks and Powder |
| color | White to beige |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| BRN | 3915222 |
| InChI | 1S/C13H30N.BrH/c1-5-6-7-8-9-10-11-12-13-14(2,3)4;/h5-13H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | PLMFYJJFUUUCRZ-UHFFFAOYSA-M |
| SMILES | [Br-].CCCCCCCCCC[N+](C)(C)C |
| CAS DataBase Reference | 2082-84-0(CAS DataBase Reference) |
| EPA Substance Registry System | Trimethyldecylammonium bromide (2082-84-0) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | BP6352000 |
| F | 3-10 |
| TSCA | TSCA listed |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 intravenous in mouse: 2800ug/kg |
