Adipic acid disodium salt
- Product NameAdipic acid disodium salt
- CAS7486-38-6
- MFC6H8Na2O4
- MW190.1
- EINECS231-293-5
- MOL File7486-38-6.mol
Chemical Properties
| Boiling point | 300℃[at 101 325 Pa] |
| pka | 4.43[at 20 ℃] |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | almost transparency |
| InChI | InChI=1S/C6H10O4.2Na/c7-5(8)3-1-2-4-6(9)10;;/h1-4H2,(H,7,8)(H,9,10);;/q;2*+1/p-2 |
| InChIKey | KYKFCSHPTAVNJD-UHFFFAOYSA-L |
| SMILES | C([O-])(=O)CCCCC([O-])=O.[Na+].[Na+] |
| LogP | -5.03 |
| EPA Substance Registry System | Hexanedioic acid, disodium salt (7486-38-6) |