| Density |
2.08 g/cm3 |
| solubility |
H2O: 1 M at 20 °C, clear, colorless |
| form |
Powder |
| color |
White to Almost white |
| PH |
pH (50g/l, 25℃) : 8.0～10.0 |
| Water Solubility |
Soluble in water (148 g/L at 20°C). |
| BRN |
3917013 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C3H4O4.2Na/c4-2(5)1-3(6)7;;/h1H2,(H,4,5)(H,6,7);;/q;2*+1/p-2 |
| InChIKey |
PRWXGRGLHYDWPS-UHFFFAOYSA-L |
| SMILES |
C([O-])(=O)CC([O-])=O.[Na+].[Na+] |
| CAS DataBase Reference |
141-95-7(CAS DataBase Reference) |
| EPA Substance Registry System |
Propanedioic acid, disodium salt (141-95-7) |
