3,4-Dimethylbenzophenone
- Product Name3,4-Dimethylbenzophenone
- CAS2571-39-3
- MFC15H14O
- MW210.27
- EINECS219-916-9
- MOL File2571-39-3.mol
Chemical Properties
| Melting point | 45-47 °C (lit.) |
| Boiling point | 335°C |
| Density | 1.0232 (rough estimate) |
| refractive index | 1.5361 (estimate) |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 1952043 |
| InChI | InChI=1S/C15H14O/c1-11-8-9-14(10-12(11)2)15(16)13-6-4-3-5-7-13/h3-10H,1-2H3 |
| InChIKey | JENOLWCGNVWTJN-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(C)C(C)=C1)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 2571-39-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,4-Dimethylbenzophenone(2571-39-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25-22-36 |
| WGK Germany | 3 |
| HS Code | 29143990 |
